Navigation :
1-Methyl-4-pyridinium carboxylate


General Description
Name | Value |
---|
Level | S-1 / C-1 |
Discovered | — / none |
Synonym | |
Molecular formula | C₇H₈NO₂ |
CAS | 824-77-1 |
SMILES | C[N+]1=CC=C(C(O)=O)C=C1 |
InChI | InChI=1S/C7H7NO2/c1-8-4-2-6(3-5-8)7(9)10/h2-5H,1H3/p+1 |
| |
Precursor 1 M⁺ | 138.05495 |
Precursor 2 | |
Precursor 3 | |
| |
HDX | 1 |
Precursor HDX 1 M(D₁)⁺ | 139.06123 |
Precursor HDX 2 | |
Precursor HDX 3 | |
| |
Rt | 1.19 |
Rt HDX | |
MS/MS fragments
m/z | Molecular formula | Annotation |
---|
138.05495 | C₇H₈NO₂ | M⁺ |
110.06004 | C₆H₈NO | [M-CO]⁺ |
94.06513 | C₆H₈N | [M-CO₂]⁺ |
Recorded MS/MS spectra
pdf | Precursor | Co-eluting | Spider | Source | Author |
---|
Data | 138.05495 | | 1-Methyl-4-pyridinium carboxylate (CAS 36455-39-7) | UZH, Bigler lab | Y. M. Forster |
References
Title | Reference | Spider | Name | Content | Link |
---|
| | | | | |
Spider species
Spider species | Family | Discovered |
---|
| | |
1-Methyl-4-pyridinium carboxylate and trigonelline can not be destinguished by Rt nor MS/MS.