Navigation :
Glycerin
General Description
Name | Value |
---|
Level | S-1 / C-4 |
Discovered | 1979 / A. robustus |
Synonym | |
Molecular formula | C₃H₈O₃ |
CAS | 56-81-5 |
SMILES | OCC(O)CO |
InChI | InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
| |
Precursor 1 [M+H]⁺ | 93.05462 |
Precursor 2 | |
Precursor 3 | |
| |
HDX | 3 |
Precursor HDX 1 [M(D₃)+D]⁺ | 97.07972 |
Precursor HDX 2 | |
Precursor HDX 3 | |
| |
Rt | |
Rt HDX | |
MS/MS fragments
m/z | Molecular formula | Annotation |
---|
| | |
Recorded MS/MS spectra
pdf | Precursor | Co-eluting | Spider | Source | Author |
---|
| | | | | |
References
Title | Reference | Spider | Name | Content | Link |
---|
Analysis of the venom of the Sydney funnel-web spider, Atrax robustus using gas chromatography mass spectrometry | P. H. Duffield, A. M. Duffield, P. R. Carroll, D. Morgans, Biomed. Mass. Spectrom. 1979, 6, 3, 105-108 | A. robustus | | GC-MS | Link |
Spider species
Spider species | Family | Discovered |
---|
Atrax robustus | Atracidae | 1979 / P. H. Duffield |