Navigation :
Glucose
General Description
Name | Value |
---|
Level | S-1 / C-4 |
Discovered | 1979 / A. robustus |
Synonym | |
Molecular formula | C₆H₁₂O₆ |
CAS | 50-99-7 |
SMILES | O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 |
InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| |
Precursor 1 [M+H]⁺ | 181.07066 |
Precursor 2 | |
Precursor 3 | |
| |
HDX | 5 |
Precursor HDX 1 [[M(D₅)+D]⁺ | 187.10833 |
Precursor HDX 2 | |
Precursor HDX 3 | |
| |
Rt | |
Rt HDX | |
MS/MS fragments
m/z | Molecular formula | Annotation |
---|
| | |
Recorded MS/MS spectra
pdf | Precursor | Co-eluting | Spider | Source | Author |
---|
| | | | | |
References
Title | Reference | Spider | Name | Content | Link |
---|
Analysis of the venom of the Sydney funnel-web spider, Atrax robustus using gas chromatography mass spectrometry | P. H. Duffield, A. M. Duffield, P. R. Carroll, D. Morgans, Biomed. Mass. Spectrom. 1979, 6, 3, 105-108 | A. robustus | | GC-MS | Link |
Biochemical analysis of tarantula venom (Eurypelma californicum) | A. Savel-Niemann, D. Roth, Naturwissenschaften 1989, 76, 5, 212-213 | A. californicum | | | Link |
Tarantula (Eurypelma californicum) venom, a multicomponent system | A. Savel-Niemann, Biol. Chem. 1989, 370, 1, 485-498 | A. californicum | | | Link |
Spider species
Spider species | Family | Discovered |
---|
Aphonopelma californicum | Theraphosidae | 1989 / A. Savel-Niemann |
Atrax robustus | Atracidae | 1979 / P. H. Duffiel |