Navigation :
Epinine
General Description
| Name | Value |
|---|
| Level | S-1 / C-4 |
| Discovered | 1987 / A. gemma |
| Synonym | |
| Molecular formula | C₉H₁₃NO₂ |
| CAS | 501-15-5 |
| SMILES | OC1=C(O)C=CC(CCNC)=C1 |
| InChI | InChI=1S/C9H13NO2/c1-10-5-4-7-2-3-8(11)9(12)6-7/h2-3,6,10-12H,4-5H2,1H3 |
| |
| Precursor 1 [M+H]⁺ | 168.10191 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 3 |
| Precursor HDX 1 [M(D₃)+D]⁺ | 172.12701 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Presence of proteins and glutamate as major constituents of the venom of the spider Araneus gemma | S. L. Early, E. K. Michaelis, Toxicon 1987, 25, 4, 433-442 | A. gemma | | HPLC | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Araneus gemma | Araneidae | 1987 / S. L. Early |