Navigation :
DOPAC
General Description
| Name | Value |
|---|
| Level | S-1 / C-4 |
| Discovered | 1987 / A. gemma |
| Synonym | |
| Molecular formula | C₈H₈O₄ |
| CAS | 102-32-9 |
| SMILES | OC1=C(O)C=CC(CC(O)=O)=C1 |
| InChI | InChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12) |
| |
| Precursor 1 [M+H]⁺ | 169.04954 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 3 |
| Precursor HDX 1 [M(D₃)+D]⁺ | 173.07464 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Presence of proteins and glutamate as major constituents of the venom of the spider Araneus gemma | S. L. Early, E. K. Michaelis, Toxicon 1987, 25, 4, 433-442 | A. gemma | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Araneus gemma | Araneidae | 1987 / S. L. Early |