Navigation :
Bis(agmatine)oxalamide
oxalamide.png)
General Description
| Name | Value |
|---|
| Level | S-1 / C-1 |
| Discovered | 1993 / P. tristis |
| Synonym | Plt-I |
| Molecular formula | C₁₂H₂₆N₈O₂ |
| CAS | 151368-32-0 |
| SMILES | NC(NCCCCNC(C(NCCCCNC(N)=N)=O)=O)=N |
| InChI | InChI=1S/C12H26N8O2/c13-11(14)19-7-3-1-5-17-9(21)10(22)18-6-2-4-8-20-12(15)16/h1-8H2,(H,17,21)(H,18,22)(H4,13,14,19)(H4,15,16,20) |
| |
| Precursor 1 [M+H]⁺ | 315.22515 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 8 |
| Precursor HDX 1 [M(D₈)+D]⁺ | 324.28164 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | 4.91 |
| Rt HDX | 3.91 |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 315.22515 | | Ariadna sp. | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | Ariadna sp. | Spider Pharm, USA | Y. M. Forster |
| Data | 315.22515 | | P. tristis | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | P. tristis | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Identification of bis(agmatine)oxalamide in venom from the primitive hunting spider, Plectreurys tristis (Simon) | G. B. Quistad, W. Lam, J. E: Casida, Toxicon 1993, 31, 7, 920-924 | P. tristis | Plt-I | FAB-MS (CI), NMR, Synthesis | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Ariadna sp. | Segestriidae | 2020 / Y. M. Forster |
| Plectreurys tristis | Plectreuridae | 1993 / G. B. Quistad |