Navigation :
5-Methoxytryptamine
General Description
| Name | Value |
|---|
| Level | S-1 / C-4 |
| Discovered | 1979 / A. robustus |
| Synonym | |
| Molecular formula | C₁₁H₁₄N₂O |
| CAS | 608-07-1 |
| SMILES | NCCC1=CNC2=C1C=C(OC)C=C2 |
| InChI | InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 |
| |
| Precursor 1 [M+H]⁺ | 191.11789 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 3 |
| Precursor HDX 1 [M(D₃)+D]⁺ | 195.14300 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Analysis of the venom of the Sydney funnel-web spider, Atrax robustus using gas chromatography mass spectrometry | P. H. Duffield, A. M. Duffield, P. R. Carroll, D. Morgeans, Biomed. Mass Spectrom. 1979, 6, 3, 105-108 | A. robustus | | GC-MS | Link |
| A comperative study of properties and toxic constituents of funnel web spiders (Atrax) venoms | D: D. Sheumack, B. A. Baldo, P. R. Carroll, F. Hampson, M. E. H. Howden, A. Skorulis, Comp. Biochem. Physiol. 1984, 78, 1, 55-68 | A. robustus | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Atrax robustus | Atracidae | 1979 / P. H. Duffield |