Navigation :
Lactic acid
General Description
| Name | Value |
|---|
| Level | S-1 / C-4 |
| Discovered | 1979 / A. robustus |
| Synonym | |
| Molecular formula | C₃H₆O₃ |
| CAS | 50-21-5 |
| SMILES | OC(C(O)C)=O |
| InChI | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| |
| Precursor 1 [M+H]⁺ | 91.03897 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 2 |
| Precursor HDX 1 [M(D₂)+D]⁺ | 94.05780 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Analysis of the venom of the Sydney funnel-web spider, Atrax robustus using gas chromatography mass spectrometry | P. H. Duffield, A. M. Duffield, P. R. Carroll, D. Morgans, Biomed. Mass. Spectrom. 1979, 6, 3, 105-108 | A. robustus | | GC-MS | Link |
| The components of the venom of a spider Scodra griseipes. 1. Analysis of low molecular weight products using gas chromatography/ mass spectrometry | C. Lange, C. Paris, M.-L. Celerier, Rapid Commun. Mass Spectrom. 1992, 6, 289-292 | S. calceatum griseipes | | GC-MS | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Atrax robustus | Atracidae | 1979 / P. H. Duffield |
| Stromatopelma calceatum griseipes | Theraphosidae | 1992 / C. Lange |