Navigation :
ATP

General Description
| Name | Value |
|---|
| Level | S-1 / C-4 |
| Discovered | 1975 / A. hentzi & Aphonopelma sp. |
| Synonym | |
| Molecular formula | C₁₀H₁₆N₅O₁₃P₃ |
| CAS | 56-65-5 |
| SMILES | OC1[C@@H](COP(OP(OP(O)(O)=O)(O)=O)(O)=O)O[C@@H](N2C=NC3=C2N=CN=C3N)C1O |
| InChI | InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6+,7?,10-/m1/s1 |
| |
| Precursor 1 [M+H]⁺ | 508.00302 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 8 |
| Precursor HDX 1 [M(D₈)+D]⁺ | 517.05951 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Adenosine triphosphate in tarantula spider venoms and its synergistic effect with the venom toxin | T. K. Chan, C. R. Geren, D. E. Howell, G. V. Odell, Toxicon 1975, 13, 1, 61-66 | A. hentzi & Aphonopelma sp. | | | Link |
| Biochemical analysis of tarantula venom (Eurypelma californicum) | A. Savel-Niemann, D. Roth, Naturwissenschaften 1989, 76, 5, 212-213 | A. californicum | | | Link |
| Tarantula (Eurypelma californicum) venom, a multicomponent system | A. Savel-Niemann, Biol. Chem. 1989, 370, 1, 485-498 | A. californicum | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Aphonopelma californicum | Theraphosidae | 1989 / A. Savel-Niemann |
| Aphonopelma hentzi | Theraphosidae | 1975 / T. K. Chan |
| Aphonopelma sp. | Theraphosidae | 1975 / T. K. Chan |