Navigation :
5'-Sulfated guanosine, 3'-α-fucose, 3'-α-fucose
General Description
| Name | Value |
|---|
| Level | S-2 / C-1 |
| Discovered | 2004 / E. agrestis |
| Synonym | |
| Molecular formula | C₂₂H₃₃N₅O₁₆S |
| CAS | 760215-09-6 |
| SMILES | OC1C(O[C@H]2[C@@H](O)[C@H](O[C@H]3[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O3)[C@H](O)[C@H](C)O2)[C@@H](COS(=O)(O)=O)O[C@H]1N4C=NC5=C4N=C(N)NC5=O |
| InChI | InChI=1S/C22H33N5O16S/c1-5-9(28)11(30)12(31)20(39-5)43-16-10(29)6(2)40-21(14(16)33)42-15-7(3-38-44(35,36)37)41-19(13(15)32)27-4-24-8-17(27)25-22(23)26-18(8)34/h4-7,9-16,19-21,28-33H,3H2,1-2H3,(H,35,36,37)(H3,23,25,26,34)/t5-,6-,7+,9+,10+,11+,12-,13?,14-,15-,16+,19+,20-,21-/m0/s1 |
| |
| Precursor 1 [M+H]⁺ | 656.17158 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 10 |
| Precursor HDX 1 [M(D₁₀)+D]⁺ | 667.24062 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 656.17158 | | E. agrestis | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | HDX | | E. agrestis | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| A new approach to natural products discovery exemplified by the identification of sulfated nucleosides in spider venom | A. E. Taggi, J. Meinwald, F. C. Schroeder, JACS 2004, 126, 33, 10364-10369 | E. agrestis | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Eratigena agrestis | Agelenidae | 2004 / F. C. Schroeder |