Navigation :
5'-Sulfated guanosine, 3'-ß-fucose
General Description
Name | Value |
---|
Level | S-2 / C-4 |
Discovered | 2004 / E. agrestis |
Synonym | |
Molecular formula | C₁₇H₂₅N₅O₁₁S |
CAS | 760215-13-2 |
SMILES | OC1C(O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)[C@@H](C)C2)[C@@H](COS(=O)(O)=O)O[C@H]1N3C=NC4=C3N=C(N)NC4=O |
InChI | InChI=1S/C17H25N5O11S/c1-5-2-6(10(24)11(25)9(5)23)32-13-7(3-31-34(28,29)30)33-16(12(13)26)22-4-19-8-14(22)20-17(18)21-15(8)27/h4-7,9-13,16,23-26H,2-3H2,1H3,(H,28,29,30)(H3,18,20,21,27)/t5-,6+,7+,9-,10-,11-,12?,13-,16+/m0/s1 |
| |
Precursor 1 [M+H]⁺ | 508.13440 |
Precursor 2 | |
Precursor 3 | |
| |
HDX | 8 |
Precursor HDX 1 [M(D₈)+D]⁺ | 517.19089 |
Precursor HDX 2 | |
Precursor HDX 3 | |
| |
Rt | |
Rt HDX | |
MS/MS fragments
m/z | Molecular formula | Annotation |
---|
| | |
Recorded MS/MS spectra
pdf | Precursor | Co-eluting | Spider | Source | Author |
---|
| | | | | |
References
Title | Reference | Spider | Name | Content | Link |
---|
A new approach to natural products discovery exemplified by the identification of sulfated nucleosides in spider venom | A. E. Taggi, J. Meinwald, F. C. Schroeder, JACS 2004, 126, 33, 10364-10369 | E. agrestis | | | Link |
Spider species
Spider species | Family | Discovered |
---|
Eratigena agrestis | Agelenidae | 2004 / F. C. Schroeder |