Navigation :
5'-Sulfated guanosine
General Description
| Name | Value |
|---|
| Level | S-2 / C-1 |
| Discovered | 2004 / E. agrestis |
| Synonym | |
| Molecular formula | C₁₀H₁₃N₅O₈S |
| CAS | 32810-44-9 |
| SMILES | OC1[C@@H](COS(=O)(O)=O)O[C@@H](N2C=NC3=C2N=C(N)NC3=O)C1O |
| InChI | InChI=1S/C10H13N5O8S/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,19,20,21)(H3,11,13,14,18)/t3-,5+,6?,9-/m1/s1 |
| |
| Precursor 1 [M+H]⁺ | 364.05576 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 6 |
| Precursor HDX 1 [M(D₆)+D]⁺ | 371.09970 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 364.05631 | | E. agrestis | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | HDX | | E. agrestis | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| A new approach to natural products discovery exemplified by the identification of sulfated nucleosides in spider venom | A. E. Taggi, J. Meinwald, F. C. Schroeder, JACS 2004, 126, 33, 10364-10369 | E. agrestis | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Eratigena agrestis | Agelenidae | 2004 / F. C. Schroeder |