Navigation :
2',5'-Bissulfated guanosine, 3'-α-fucose

General Description
| Name | Value |
|---|
| Level | S-2 / C-4 |
| Discovered | 2004 / E. agrestis |
| Synonym | |
| Molecular formula | C₁₆H₂₃N₅O₁₅S₂ |
| CAS | 760215-12-1 |
| SMILES | O=C1C(N=CN2[C@H]3C(OS(=O)(O)=O)C(O[C@H]4[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O4)[C@@H](COS(=O)(O)=O)O3)=C2N=C(N)N1 |
| InChI | InChI=1S/C16H23N5O15S2/c1-4-7(22)8(23)9(24)15(33-4)35-10-5(2-32-37(26,27)28)34-14(11(10)36-38(29,30)31)21-3-18-6-12(21)19-16(17)20-13(6)25/h3-5,7-11,14-15,22-24H,2H2,1H3,(H,26,27,28)(H,29,30,31)(H3,17,19,20,25)/t4-,5+,7+,8+,9-,10-,11?,14+,15-/m0/s1 |
| |
| Precursor 1 [M+H]⁺ | 590.07048 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 8 |
| Precursor HDX 1 [M(D₈)+D]⁺ | 599.12697 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| A new approach to natural products discovery exemplified by the identification of sulfated nucleosides in spider venom | A. E. Taggi, J. Meinwald, F. C. Schroeder, JACS 2004, 126, 33, 10364-10369 | E. agrestis | | | Link |
| NMR-spectroscopic screening of spider venom reveals sulfated nucleosides as major components for the brown recluse and related species | F. C. Schroeder, A. E. Taggi, M. Gronquist, R. U. Malik, J. B. Grant, T. Eisner, J. Meinwald, PNAS 2008, 105, 38, 14283-14287 | E. agrestis | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Eratigena agrestis | Agelenidae | 2004 / F. C. Schroeder |