Navigation :
2',5'-Bissulfated guanosine
General Description
| Name | Value |
|---|
| Level | S-2 / C-4 |
| Discovered | 2008 / C. pastoralis & Loxosceles sp. |
| Synonym | |
| Molecular formula | C₁₀H₁₃N₅O₁₁S₂ |
| CAS | 790607-53-3 |
| SMILES | OC1[C@@H](COS(=O)(O)=O)O[C@@H](N2C=NC3=C2N=C(N)NC3=O)C1OS(=O)(O)=O |
| InChI | InChI=1S/C10H13N5O11S2/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-6(26-28(21,22)23)5(16)3(25-9)1-24-27(18,19)20/h2-3,5-6,9,16H,1H2,(H,18,19,20)(H,21,22,23)(H3,11,13,14,17)/t3-,5+,6?,9-/m1/s1 |
| |
| Precursor 1 [M+H]⁺ | 444.01257 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 6 |
| Precursor HDX 1 [M(D₆)+D]⁺ | 451.05651 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| NMR-spectroscopic screening of spider venom reveals sulfated nucleosides as major components for the brown recluse and related species | F. C. Schroeder, A. E. Taggi, M. Gronquist, R. U. Malik, J. B. Grant, T. Eisner, J. Meinwald, PNAS 2008, 105, 38, 14283-14287 | C. pastoralis & Loxosceles sp. | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Coelotes pastoralis | Agelenidae | 2008 / F. C. Schroeder |
| Loxosceles arizonica | Sicariidae | 2008 / F. C. Schroeder |
| Loxosceles deserta | Sicariidae | 2008 / F. C. Schroeder |
| Loxosceles reclusa | Sicariidae | 2008 / F. C. Schroeder |