Navigation :
Dopamine
General Description
| Name | Value |
|---|
| Level | S-1 / C-1 |
| Discovered | 1987 / A. gemma |
| Synonym | |
| Molecular formula | C₈H₁₁NO₂ |
| CAS | 51-61-6 |
| SMILES | OC1=C(O)C=CC(CCN)=C1 |
| InChI | InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2 |
| |
| Precursor 1 [M+H]⁺ | 154.08626 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 4 |
| Precursor HDX 1 [M(D₄)+D]⁺ | 159.11764 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | 2.04 |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| 154.08626 | C₈H₁₂NO₂ | [M+H]⁺ |
| 137.05971 | C₈H₉O₂ | [M+H-NH₃]⁺ |
| 119.04914 | C₈H₇O | |
| 109.06479 | C₇H₉O | |
| 91.05423 | C₇H₇ | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 154.08626 | | Dopamine HCL (CAS 62-31-7) | Fluorochem | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Presence of proteins and glutamate as major constituents of the venom of the spider Araneus gemma | S. L. Early, E. K. Michaelis, Toxicon 1987, 25, 4, 433-442 | A. gemma | | HPLC | Link |
| Identification of noradrenaline in venom from the funnel-web spider Hololena curta | R. Frew, M. G. Hamilton, P. M. Lundy, Toxicon 1994, 32, 4, 511-515 | H. curta | | HPLC | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Araneus gemma | Araneidae | 1987 / S. L. Early |
| Hololena curta | Agelenidae | 1994 / R. Frew |