Navigation :
Threonine
General Description
| Name | Value |
|---|
| Level | S-1 / C-1 |
| Discovered | 1994 / C. salei |
| Synonym | |
| Molecular formula | C₄H₉NO₃ |
| CAS | 72-19-5 |
| SMILES | OC(C(N)C(O)C)=O |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) |
| |
| Precursor 1 [M+H]⁺ | 120.06552 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 4 |
| Precursor HDX 1 [M(D₄)+D]⁺ | 125.09690 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | 1.14 |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| 120.06552 | C₄H₁₀NO₃ | [M+H]⁺ |
| 102.05495 | C₄H₈NO₂ | [M+H-H₂O]⁺ |
| 84.04439 | C₄H₆NO | [M+H-2H₂O]⁺ |
| 74.06004 | C₃H₈NO | [M+H-HCOOH]⁺ |
| 56.04948 | C₃H₆N | [M+H-HCOOH-H₂O]⁺ |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 120.06552 | | L-Threonine | Fluka | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Cupiennius salei | Cupiennius | 1994 / L. Kuhn-Nentwig |