Navigation :
Serine
General Description
| Name | Value |
|---|
| Level | S-1 / C-1 |
| Discovered | 1994 / C. salei |
| Synonym | |
| Molecular formula | C₃H₇NO₃ |
| CAS | 56-45-1 |
| SMILES | OC(C(N)CO)=O |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
| |
| Precursor 1 [M+H]⁺ | 106.04987 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 4 |
| Precursor HDX 1 [M(D₄)+D]⁺ | 111.08125 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | 1.10 |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| 106.04987 | C₃H₈NO₃ | [M+H]⁺ |
| 88.03930 | C₃H₆NO₂ | [M+H-H₂O]⁺ |
| 70.02874 | C₃H₄NO | [M+H-2H₂O]⁺ |
| 60.04439 | C₂H₆NO | [M+H-HCOOH]⁺ |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 106.04987 | | L-Serine | Sigma Aldrich | Y. M. Forster |
| Data | 106.04987 | | L. mactans | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Cupiennius salei | Cupiennius | 1994 / L. Kuhn-Nentwig |
| Latrodectus mactans | Theridiidae | 2020 / Y. M. Forster |