Navigation :
Proline
General Description
| Name | Value |
|---|
| Level | S-1 / C-1 |
| Discovered | 1979 / A. robustus |
| Synonym | |
| Molecular formula | C₅H₉NO₂ |
| CAS | 147-85-3 |
| SMILES | OC(C1NCCC1)=O |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8) |
| |
| Precursor 1 [M+H]⁺ | 116.07061 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 1 |
| Precursor HDX 1 [M(D₁)+D]⁺ | 118.08316 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | 1.20 |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| 116.07061 | C₅H₁₀NO₂ | [M+H]⁺ |
| 70.06513 | C₄H₈N | [M+H-HCOOH]⁺ |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 116.07061 | | L-Proline | Acros Organics | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Preliminary studies on the venom of three Indian spider | G. Ridling Margaret, G. J. Phanuel, Proc. Indian Acad. Sci. 1988, 97, 3, 231-237 | L. indagatrix | | paper chromatography | Link |
| Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Cupiennius salei | Ctenidae | 1994 / L. Kuhn-Nentwig |
| Lycosa indagatrix | Lycosidae | 1988 / G. Ridling Margaret |