Navigation :
Ornithine
General Description
Name | Value |
---|
Level | S-1 / C-1 |
Discovered | 1994 / C. salei |
Synonym | |
Molecular formula | C₅H₁₂N₂O₂ |
CAS | 70-26-8 |
SMILES | OC(C(N)CCCN)=O |
InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
| |
Precursor 1 [M+H]⁺ | 133.09715 |
Precursor 2 | |
Precursor 3 | |
| |
HDX | 5 |
Precursor HDX 1 [M(D₅)+D]⁺ | 139.13481 |
Precursor HDX 2 | |
Precursor HDX 3 | |
| |
Rt | 1.06 |
Rt HDX | |
MS/MS fragments
m/z | Molecular formula | Annotation |
---|
133.09715 | C₅H₁₃N₂O₂ | [M+H]⁺ |
116.07061 | C₅H₁₀NO₂ | [M+H-NH₃]⁺ |
115.08659 | C₅H₁₁N₂O | [M+H-H₂O]⁺ |
73.06479 | C₄H₉O | |
70.06513 | C₄H₈N | |
Recorded MS/MS spectra
pdf | Precursor | Co-eluting | Spider | Source | Author |
---|
Data | 133.09715 | | L-Ornithine | Fluka | Y. M. Forster |
References
Title | Reference | Spider | Name | Content | Link |
---|
Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
Spider species | Family | Discovered |
---|
Cupiennius salei | Ctenidae | 1994 / L. Kuhn-Nentwig |