Navigation :
Methionine
General Description
Name | Value |
---|
Level | S-1 / C-3 |
Discovered | 1988 / L. indagatrix |
Synonym | |
Molecular formula | C₅H₁₁NO₂S |
CAS | 63-68-3 |
SMILES | OC(C(N)CCSC)=O |
InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| |
Precursor 1 [M+H]⁺ | 150.05831 |
Precursor 2 | |
Precursor 3 | |
| |
HDX | 3 |
Precursor HDX 1 [M(D₃)+D]⁺ | 154.08343 |
Precursor HDX 2 | |
Precursor HDX 3 | |
| |
Rt | |
Rt HDX | |
MS/MS fragments
m/z | Molecular formula | Annotation |
---|
| | |
Recorded MS/MS spectra
pdf | Precursor | Co-eluting | Spider | Source | Author |
---|
| | | | | |
References
Title | Reference | Spider | Name | Content | Link |
---|
Preliminary studies on the venom of three Indian spider | G. Ridling Margaret, G. J. Phanuel, Proc. Indian Acad. Sci. 1988, 97, 3, 231-237 | L. indagatrix | | paper chromatography | Link |
Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
Spider species | Family | Discovered |
---|
Cupiennius salei | Cupiennius | 1994 / L. Kuhn-Nentwig |
Lycosa indagatrix | Lycosidae | 1988 / G. Ridling Margaret |