Navigation :
Histidine
General Description
| Name | Value |
|---|
| Level | S-1 / C-1 |
| Discovered | 1994 / C. salei |
| Synonym | |
| Molecular formula | C₆H₉N₃O₂ |
| CAS | 71-00-1 |
| SMILES | OC(C(N)CC1=CNC=N1)=O |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) |
| |
| Precursor 1 [M+H]⁺ | 156.07675 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 4 |
| Precursor HDX 1 [M(D₄)+D]⁺ | 161.10814 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | 1.10 |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| 156.07675 | C₆H₁₀N₃O₂ | [M+H]⁺ |
| 110.07127 | C₅H₈N₃ | [M+H-HCOOH]⁺ |
| 95.06037 | C₅H₇N₂ | |
| 93.04472 | C₅H₅N₂ | [M+H-HCOOH-NH₃]⁺ |
| 83.06037 | C₄H₇N₂ | |
| 82.05255 | C₄H₆N₂ | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 156.07675 | | L-Histidine | Fluka | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Cupiennius salei | Cupiennius | 1994 / L. Kuhn-Nentwig |