Navigation :
Glycine
General Description
| Name | Value |
|---|
| Level | S-1 / C-4 |
| Discovered | 1979 / A. robustus |
| Synonym | |
| Molecular formula | C₂H₅NO₂ |
| CAS | 56-40-6 |
| SMILES | OC(CN)=O |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
| |
| Precursor 1 [M+H]⁺ | 76.03930 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 3 |
| Precursor HDX 1 [M(D₃)+D]⁺ | 80.06441 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Analysis of the venom of the Sydney funnel-web spider, Atrax robustus using gas chromatography mass spectrometry | P. H. Duffield, A. M. Duffield, P. R. Carroll, D. Morgans, Biomed. Mass. Spectrom. 1979, 6, 3, 105-108 | A. robustus | | GC-MS | Link |
| Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Atrax robustus | Atracidae | 1979 / P. H. Duffield |
| Cupiennius salei | Cupiennius | 1994 / L. Kuhn-Nentwig |