Navigation :
Cysteine
General Description
| Name | Value |
|---|
| Level | S-1 / C-1 |
| Discovered | 1988 / L. indagatrix |
| Synonym | |
| Molecular formula | C₃H₇NO₂S |
| CAS | 52-90-4 |
| SMILES | OC(C(N)CS)=O |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| |
| Precursor 1 [M+H]⁺ | 122.02703 |
| Precursor 2 | |
| Precursor 3 | |
| |
| HDX | 4 |
| Precursor HDX 1 [M(D₄)+D]⁺ | 127.05841 |
| Precursor HDX 2 | |
| Precursor HDX 3 | |
| |
| Rt | 1.17 |
| Rt HDX | |
MS/MS fragments
| m/z | Molecular formula | Annotation |
|---|
| 122.02703 | C₃H₈NO₂S | [M+H]⁺ |
| 105.00048 | C₃H₅O₂S | [M+H-NH₃]⁺ |
| 86.98991 | C₃H₃OS | [M+H-NH₃-H₂O]⁺ |
| 76.02155 | C₂H₆NS | [M+H-HCOOH]⁺ |
| 58.99500 | C₂H₃S | |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 122.02703 | | L-Cysteine | Fluka | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Preliminary studies on the venom of three Indian spider | G. Ridling Margaret, G. J. Phanuel, Proc. Indian Acad. Sci. 1988, 97, 3, 231-237 | L. indagatrix | | paper chromatography | Link |
| Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Cupiennius salei | Ctenidae | 1994 / L. Kuhn-Nentwig |
| Lycosa indagatrix | Lycosidae | 1988 / G. Ridling Margaret |