Navigation :
Alanine
General Description
Name | Value |
---|
Level | S-1 / C-4 |
Discovered | 1994 / C. salei |
Synonym | |
Molecular formula | C₃H₇NO₂ |
CAS | 56-41-7 |
SMILES | OC(C(N)C)=O |
InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
| |
Precursor 1 [M+H]⁺ | 90.05495 |
Precursor 2 | |
Precursor 3 | |
| |
HDX | 3 |
Precursor HDX 1 [M(D₃)+D]⁺ | 94.08006 |
Precursor HDX 2 | |
Precursor HDX 3 | |
| |
Rt | |
Rt HDX | |
MS/MS fragments
m/z | Molecular formula | Annotation |
---|
| | |
Recorded MS/MS spectra
pdf | Precursor | Co-eluting | Spider | Source | Author |
---|
| | | | | |
References
Title | Reference | Spider | Name | Content | Link |
---|
Purification of toxic peptides and the amino acid sequence of CSTX-1 from the multicomponent venom of Cupiennius salei (Araneae: Ctenidae) | L. Kuhn-Nentwig, J. Schaller, W. Nentwig, Toxicon 1994, 32, 3, 287-302 | C. salei | | | Link |
Spider species
Spider species | Family | Discovered |
---|
Cupiennius salei | Cupiennius | 1994 / L. Kuhn-Nentwig |