Navigation :
TyrAsn343

General Description
| Name | Value |
|---|
| Level | S-1 / C-3 |
| Discovered | 1989 / A. californicum |
| Synonym | — |
| Molecular formula | C₂₃H₄₁N₇O₄ |
| CAS | 330162-89-5 |
| SMILES | O=C(NC(CC(N)=O)C(NCCCNCCCCNCCCN)=O)C(N)CC1=CC=C(O)C=C1 |
| InChI | InChI=1S/C23H41N7O4/c24-9-3-12-27-10-1-2-11-28-13-4-14-29-23(34)20(16-21(26)32)30-22(33)19(25)15-17-5-7-18(31)8-6-17/h5-8,19-20,27-28,31H,1-4,9-16,24-25H2,(H2,26,32)(H,29,34)(H,30,33) |
| |
| Precursor 1 [M+H]⁺ | 480.32928 |
| Precursor 2 [M+2H]²⁺ | 240.66828 |
| Precursor 3 | |
| |
| HDX | 8 |
| Precursor HDX 1 [M(D₈)+D]⁺ | 489.38577 |
| Precursor HDX 2 [M(D₈)+2D]²⁺ | 245.69966 |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 278.11353 | 260.10297 | 261.08698 | 295.14008 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 335.17138 | 317.16082 | 318.14483 | 352.19793 | 129.13862 | 112.11208 | 146.16517 |
| 3 | 406.24488 | 388.23432 | 389.21833 | 423.27143 | 186.19647 | 169.16993 | 203.22302 |
| 4 | 463.30273 | 445.29217 | 446.27618 | 480.32928 | 300.23940 | 283.21285 | 317.26595 |
Additional MS/MS fragments
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Tarantula (Eurypelma californicum) venom, a multicomponent system | A. Savel-Niemann, Biol. Chem. Hoppe-Seyler 1989, 370, 485-498 | A. californicum | | HPLC, Amino acid analysis | Link |
| Amino acid/spermine conjugates: Polyamine amides as potent spermidine uptake inhibitors | M. R. Burns, C. L. Carlson, S. M. Vanderwerf, J. R. Ziemer, R. S. Weeks, F. Cai, H. K. Webb, G. F. Graminski, J. Med. Chem. 2001, 44, 3632-3644 | — | (35) | Synthesis, NMR, Activity-studies | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Aphonopelma californicum* | Theraphosidae | 1989 / A. Savel-Niemann |