Navigation :
PhLacAsn353
General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2009 / L. patagiatus |
| Synonym | LF 478B |
| Molecular formula | C₂₄H₄₂N₆O₄ |
| CAS | — |
| SMILES | O=C(NC(CC(N)=O)C(NCCCNCCCCCNCCCN)=O)C(O)CC1=CC=CC=C1 |
| InChI | InChI=1S/C24H42N6O4/c25-11-7-14-27-12-5-2-6-13-28-15-8-16-29-23(33)20(18-22(26)32)30-24(34)21(31)17-19-9-3-1-4-10-19/h1,3-4,9-10,20-21,27-28,31H,2,5-8,11-18,25H2,(H2,26,32)(H,29,33)(H,30,34) |
| |
| Precursor 1 [M+H]⁺ | 479.33403 |
| Precursor 2 [M+2H]²⁺ | 240.17065 |
| Precursor 3 | |
| |
| HDX | 9 |
| Precursor HDX 1 [M(D₉)+D]⁺ | 489.39680 |
| Precursor HDX 2 [M(D₉)+2D]²⁺ | 245.70518 |
| Precursor HDX 3 | |
| |
| Rt | 6.59 |
| Rt HDX | 5.62 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 263.10263 | 245.09207 | 246.07608 | 280.12918 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 320.16048 | 302.14992 | 303.13393 | 337.18703 | 143.15428 | 126.12773 | 160.18082 |
| 3 | 405.24963 | 387.23907 | 388.22308 | 422.27618 | 200.21212 | 183.18558 | 217.23867 |
| 4 | 462.30748 | 444.29692 | 445.28093 | 479.33403 | 314.25505 | 297.22850 | 331.28160 |
Additional MS/MS fragments
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 479.33403 | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | L. patagiatus | LF 478B | nLC-ESI-MS/MS, Amino acid analysis | Link |
| Low molecular mass compounds in spider venom | Y. M. Forster, S. Bienz, L. Bigler, 2020, in preparation | div. | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Larinioides cornutus | Araneidae | 2020 / Y. M. Forster |
| Larinioides patagiatus | Araneidae | 2009 / S. Eichenberger |