Navigation :
PheAsn3(Me)43
43.png)
General Description
| Name | Value | 
|---|
| Level | S-3 / C-1 | 
| Discovered | 2009 / L. patagiatus | 
| Synonym | LF 477A | 
| Molecular formula | C₂₄H₄₃N₇O₃ | 
| CAS | — | 
| SMILES | O=C(NC(CC(N)=O)C(NCCCN(C)CCCCNCCCN)=O)C(N)CC1=CC=CC=C1 | 
| InChI | InChI=1S/C24H43N7O3/c1-31(15-6-5-12-28-13-7-11-25)16-8-14-29-24(34)21(18-22(27)32)30-23(33)20(26)17-19-9-3-2-4-10-19/h2-4,9-10,20-21,28H,5-8,11-18,25-26H2,1H3,(H2,27,32)(H,29,34)(H,30,33) | 
 |  | 
| Precursor 1 [M+H]⁺ | 478.35001 | 
| Precursor 2 [M+2H]²⁺ | 239.67865 | 
| Precursor 3 |  | 
 |  | 
| HDX | 9 | 
| Precursor HDX 1 [M(D₉)+D]⁺ | 488.41278 | 
| Precursor HDX 2 [M(D₉)+2D]²⁺ | 245.21317 | 
| Precursor HDX 3 |  | 
 |  | 
| Rt | 2.72 | 
| Rt HDX | 2.15 | 
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz | 
|---|
| 1 | 262.11862 | 244.10805 | 245.09207 | 279.14517 | 58.06513 | 41.03858 | 75.09167 | 
| 2 | 319.17647 | 301.16590 | 302.14992 | 350.21867 | 129.13862 | 112.11208 | 160.18082 | 
| 3 | 404.26562 | 386.25505 | 387.23907 | 421.29217 | 200.21212 | 183.18558 | 217.23867 | 
| 4 | 461.32347 | 443.31290 | 444.29692 | 478.35001 | 314.25505 | 297.22850 | 331.28160 | 
Additional MS/MS fragments
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author | 
|---|
| Data | 478.35001 |  | L. cornutus | Spider Pharm, USA | Y. M. Forster | 
| Data | HDX |  | L. cornutus | Spider Pharm, USA | Y. M. Forster | 
References
| Title | Reference | Spider | Name | Content | Link | 
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | L. patagiatus | LF 477A | nLC-ESI-MS/MS, Amino acid analysis | Link | 
| Low molecular mass compounds in spider venom | Y. M. Forster, S. Bienz, L. Bigler, 2020, in preparation | div. |  |  | Link | 
Spider species
| Spider species | Family | Discovered | 
|---|
| Larinioides cornutus | Araneidae | 2020 / Y. M. Forster | 
| Larinioides patagiatus | Araneidae | 2009 / S. Eichenberger |