Navigation :
PheAsn353
General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2009 / L. patagiatus |
| Synonym | LF 477B |
| Molecular formula | C₂₄H₄₃N₇O₃ |
| CAS | — |
| SMILES | O=C(NC(CC(N)=O)C(NCCCNCCCCCNCCCN)=O)C(N)CC1=CC=CC=C1 |
| InChI | InChI=1S/C24H43N7O3/c25-11-7-14-28-12-5-2-6-13-29-15-8-16-30-24(34)21(18-22(27)32)31-23(33)20(26)17-19-9-3-1-4-10-19/h1,3-4,9-10,20-21,28-29H,2,5-8,11-18,25-26H2,(H2,27,32)(H,30,34)(H,31,33) |
| |
| Precursor 1 [M+H]⁺ | 478.35001 |
| Precursor 2 [M+2H]²⁺ | 239.67865 |
| Precursor 3 | |
| |
| HDX | 10 |
| Precursor HDX 1 [M(D₁₀)+D]⁺ | 489.41906 |
| Precursor HDX 2 [M(D₁₀)+2D]²⁺ | 245.71631 |
| Precursor HDX 3 | |
| |
| Rt | 3.07 |
| Rt HDX | 2.47 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 262.11862 | 244.10805 | 245.09207 | 279.14517 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 319.17647 | 301.16590 | 302.14992 | 336.20302 | 143.15428 | 126.12773 | 160.18082 |
| 3 | 404.26562 | 386.25505 | 387.23907 | 421.29217 | 200.21212 | 183.18558 | 217.23867 |
| 4 | 461.32347 | 443.31290 | 444.29692 | 478.35001 | 314.25505 | 297.22850 | 331.28160 |
Additional MS/MS fragments
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 478.35001 | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
| Data | 239.67865 | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | L patagiatus | LF 477B | nLC-ESI-MS/MS, Amino acid analysis | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Larinioides cornutus | Araneidae | 2020 / Y. M. Forster |
| Larinioides patagiatus | Araneidae | 2009 / S. Eichenberger |