Navigation :
IndAcAsn5Gly4ßAla4
General Description
| Name | Value |
|---|
| Level | S-4 / C-3 |
| Discovered | 1997 / N. borbonica |
| Synonym | NPTX 643 / NPTX 643C |
| Molecular formula | C₃₂H₅₃N₉O₅ |
| CAS | 205673-37-6 |
| SMILES | O=C(NC(CC(N)=O)C(NCCCCCNC(CNCCCCNC(CCNCCCCN)=O)=O)=O)CC1=CNC2=C1C=CC=C2 |
| InChI | InChI=1S/C32H53N9O5/c33-13-4-7-14-35-19-12-29(43)37-17-9-8-15-36-23-31(45)38-16-5-1-6-18-39-32(46)27(21-28(34)42)41-30(44)20-24-22-40-26-11-3-2-10-25(24)26/h2-3,10-11,22,27,35-36,40H,1,4-9,12-21,23,33H2,(H2,34,42)(H,37,43)(H,38,45)(H,39,46)(H,41,44) |
| |
| Precursor 1 [M+H]⁺ | 644.42424 |
| Precursor 2 [M+2H]²⁺ | 322.71576 |
| Precursor 3 | |
| |
| HDX | 11 |
| Precursor HDX 1 [M(D₁₁)+D]⁺ | 656.49956 |
| Precursor HDX 2 [M(D₁₁)+2D]²⁺ | 329.25656 |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 272.10297 | 254.09240 | 255.07642 | 289.12952 | 72.08078 | 55.05423 | 89.10732 |
| 2 | 357.19212 | 339.18155 | 340.16557 | 374.21867 | 143.11789 | 126.09134 | 160.14444 |
| 3 | 414.21358 | 396.20302 | 397.18703 | 431.24013 | 214.19139 | 197.16484 | 231.21794 |
| 4 | 485.28708 | 467.27652 | 468.26053 | 502.31363 | 271.21285 | 254.18630 | 288.23940 |
| 5 | 556.32419 | 538.31363 | 539.29764 | 573.35074 | 356.30200 | 339.27545 | 373.32855 |
| 6 | 627.39769 | 609.38713 | 610.37114 | 644.42424 | 470.34493 | 453.31838 | 487.37148 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 130.06513 | a’ |
| 158.06004 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Detection of new spider toxins from a Nephilengys borbonica venom gland using on-line µ-column HPLC continuous flow (FRIT) FAB LC/MS and MS/MS | Y. Itagaki, T. Fujita, H. Naoki, T. Yasuhara, M. Andriantsiferana, T. Nakajima, Nat. Toxins 1997, 5, 1-13 | N. borbonica | NPTX 643 | LC-FAB-MS | Link |
| Total synthesis of NPTX-643, a neurotoxin of the Madagascar spider (Nephilengys borbonica) having a novel acylpolyamine structure | M. Miyashita, T. Kanemura, M. Matsushita, S. Hatakeyama, Y. Itagaki, T. Nakajima, M. Miyazawa, H. Irie, Heterocycles 1998, 47, 171-175 | | NPTX 643 | Synthesis | Link |
| Acylpolyamines: Mass spectrometric analytical methods for Araneidae spider acylpolyamines | Y. Itagaki , T. Nakajima , Toxin Rev. 2000, 19, 23-52 | N. borbonica | NPTX 643C | Review | Link |
| A natural combinatorial chemistry strategy in acylpolyamine toxins from Nephilinae orb-web spiders | M. S. Palma, T. Nakajima, Toxin Rev. 2005, 24, 209-234 | div. | NPTX 643C | LC-MS | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Nephila clavata | Araneidae | 2005 / M. S. Palma |
| Trichonephila inaurata madagascariensis | Araneidae | M. S. Palma |
| Nephilingis borbonica | Araneidae | 1997 / Y. Itagaki |
| Nephilingis cruentata | Araneidae | M. S. Palma |