Navigation :
IndAcAsn53
General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2009 / L. patagiatus |
| Synonym | LF 430F |
| Molecular formula | C₂₂H₃₄N₆O₃ |
| CAS | — |
| SMILES | O=C(NC(CC(N)=O)C(NCCCCCNCCCN)=O)CC1=CNC2=C1C=CC=C2 |
| InChI | InChI=1S/C22H34N6O3/c23-9-6-11-25-10-4-1-5-12-26-22(31)19(14-20(24)29)28-21(30)13-16-15-27-18-8-3-2-7-17(16)18/h2-3,7-8,15,19,25,27H,1,4-6,9-14,23H2,(H2,24,29)(H,26,31)(H,28,30) |
| |
| Precursor 1 [M+H]⁺ | 431.27652 |
| Precursor 2 [M+2H]²⁺ | 216.14190 |
| Precursor 3 | |
| |
| HDX | 8 |
| Precursor HDX 1 [M(D₈)+D]⁺ | 440.33301 |
| Precursor HDX 2 [M(D₈)+2D]²⁺ | 221.17328 |
| Precursor HDX 3 | |
| |
| Rt | 10.15 |
| Rt HDX | 8.92 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 272.10297 | 254.09240 | 255.07642 | 289.12952 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 357.19212 | 339.18155 | 340.16557 | 374.21867 | 143.15428 | 126.12773 | 160.18082 |
| 3 | 414.24997 | 396.23940 | 397.22342 | 431.27652 | 257.19720 | 240.17065 | 274.22375 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 130.06513 | a’ |
| 158.06004 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 431.27652 | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | L. patagiatus | LF 430F | nLC-ESI-MS/MS, Amino acid analysis | Link |
| Low molecular mass compounds in spider venom | Y. M. Forster, S. Bienz, L. Bigler, 2020, in preparation | div. | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Larinioides cornutus | Araneidae | 2020 / Y. M. Forster |
| Larinioides patagiatus | Araneidae | 2009 / S. Eichenberger |