Navigation :
IndAcAsn343
General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2009 / L. patagiatus |
| Synonym | LF 473D |
| Molecular formula | C₂₄H₃₉N₇O₃ |
| CAS | — |
| SMILES | O=C(CC1=CNC2=C1C=CC=C2)NC(CC(N)=O)C(NCCCNCCCCNCCCN)=O |
| InChI | InChI=1S/C24H39N7O3/c25-9-5-12-27-10-3-4-11-28-13-6-14-29-24(34)21(16-22(26)32)31-23(33)15-18-17-30-20-8-2-1-7-19(18)20/h1-2,7-8,17,21,27-28,30H,3-6,9-16,25H2,(H2,26,32)(H,29,34)(H,31,33) |
| |
| Precursor 1 [M+H]⁺ | 474.31871 |
| Precursor 2 [M+2H]²⁺ | 237.66300 |
| Precursor 3 | |
| |
| HDX | 9 |
| Precursor HDX 1 [M(D₉)+D]⁺ | 484.38148 |
| Precursor HDX 2 [M(D₉)+2D]²⁺ | 243.19752 |
| Precursor HDX 3 | |
| |
| Rt | 7.30 |
| Rt HDX | 6.11 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 272.10297 | 254.09240 | 255.07642 | 289.12952 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 329.16082 | 311.15025 | 312.13427 | 346.18737 | 129.13862 | 112.11208 | 146.16517 |
| 3 | 400.23432 | 382.22375 | 383.20777 | 417.26087 | 186.19647 | 169.16993 | 203.22302 |
| 4 | 457.29217 | 439.28160 | 440.26562 | 474.31871 | 300.23940 | 283.21285 | 317.26595 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 130.06513 | a’ |
| 158.06004 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 474.31871 | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | L. cornutus | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | L. patagiatus | LF 473D | nLC-ESI-MS/MS, Amino acid analysis | Link |
| Low molecular mass compounds in spider venom | Y. M. Forster, S. Bienz, L. Bigler, 2020, in preparation | div. | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Larinioides cornutus | Araneidae | 2020 / Y. M. Forster |
| Larinioides patagiatus | Araneidae | 2009 / S. Eichenberger |