Navigation :
IndAcßAla343
General Description
| Name | Value |
|---|
| Level | S-3 / C-3 |
| Discovered | 2009 / Lachesana sp. |
| Synonym | LH 430 |
| Molecular formula | C₂₃H₃₈N₆O₂ |
| CAS | — |
| SMILES | O=C(NCCC(NCCCNCCCCNCCCN)=O)CC1=CNC2=C1C=CC=C2 |
| InChI | InChI=1S/C23H38N6O2/c24-10-5-13-25-11-3-4-12-26-14-6-15-27-22(30)9-16-28-23(31)17-19-18-29-21-8-2-1-7-20(19)21/h1-2,7-8,18,25-26,29H,3-6,9-17,24H2,(H,27,30)(H,28,31) |
| |
| Precursor 1 [M+H]⁺ | 431.31290 |
| Precursor 2 [M+2H]²⁺ | 216.16009 |
| Precursor 3 | |
| |
| HDX | 7 |
| Precursor HDX 1 [M(D₇)+D]⁺ | 439.36311 |
| Precursor HDX 2 [M(D₇)+2D]²⁺ | 220.68833 |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 229.09715 | 211.08659 | 212.07060 | 246.12370 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 286.15500 | 268.14444 | 269.12845 | 303.18155 | 129.13862 | 112.11208 | 146.16517 |
| 3 | 357.22850 | 339.21794 | 340.20195 | 374.25505 | 186.19647 | 169.16993 | 203.22302 |
| 4 | 414.28635 | 396.27579 | 397.25980 | 431.31290 | 257.23359 | 240.20704 | 274.26014 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 130.06513 | a’ |
| 158.06004 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | Lachesana sp. | LH 430 | nLC-ESI-MS/MS | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Lachesana sp. | Zodariidae | 2009 / S. Eichenberger |