Navigation :
Ac34

General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2020 / A. robustus |
| Synonym | — |
| Molecular formula | C₉H₂₁N₃O |
| CAS | — |
| SMILES | NCCCCNCCCNC(C)=O |
| InChI | InChI=1S/C9H21N3O/c1-9(13)12-8-4-7-11-6-3-2-5-10/h11H,2-8,10H2,1H3,(H,12,13) |
| |
| Precursor 1 [M+H]⁺ | 188.17574 |
| Precursor 2 [M+2H]²⁺ | 94.59151 |
| Precursor 3 | |
| |
| HDX | 4 |
| Precursor HDX [M(D₄)+D]⁺ | 193.20712 |
| Precursor HDX 2 [M(D₄)+2D]²⁺ | 97.61034 |
| Precursor HDX 3 | |
| |
| Rt | 1.18 |
| Rt HDX | 1.15 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 100.07569 | 82.06513 | 83.04914 | 117.10224 | 72.08078 | 55.05423 | 89.10732 |
| 2 | 171.14919 | 153.13862 | 154.12264 | 188.17574 | 129.13862 | 112.11208 | 146.16517 |
Additional MS/MS fragments
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 188.17574 | | A. robustus | Alpha Biotoxin, BEL | Y. M. Forster |
| Data | HDX | | A. robustus | Alpha Biotoxin, BEL | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Data | 131.11844 | | P. bistriata | Prof. Dr. Wagner Ferreira dos Santos, BRA | Y. M. Forster |
Spider species
| Spider species | Family | Discovered |
|---|
| Atrax robustus | Atracidae | 2020 / Y. M. Forster |