Navigation :
4-OH-IndAcLysMe₂5(Me)3Arg
3Arg.png)
General Description
| Name | Value |
|---|
| Level | S-4 / C-3 |
| Discovered | 1989 / A. lobata |
| Synonym | Arg 658 / Argiopinin 5 |
| Molecular formula | C₃₃H₅₈N₁₀O₄ |
| CAS | 117233-44-0 |
| SMILES | O=C(NC(CCCCN(C)C)C(NCCCCCN(C)CCCNC(C(N)CCCNC(N)=N)=O)=O)CC1=CNC2=C1C(O)=CC=C2 |
| InChI | InChI=1S/C33H58N10O4/c1-42(2)19-8-5-13-27(41-29(45)22-24-23-40-26-14-9-15-28(44)30(24)26)32(47)38-16-6-4-7-20-43(3)21-11-18-37-31(46)25(34)12-10-17-39-33(35)36/h9,14-15,23,25,27,40,44H,4-8,10-13,16-22,34H2,1-3H3,(H,37,46)(H,38,47)(H,41,45)(H4,35,36,39) |
| |
| Precursor 1 [M+H]⁺ | 659.47153 |
| Precursor 2 [M+2H]²⁺ | 330.23940 |
| Precursor 3 | |
| |
| HDX | 11 |
| Precursor HDX 1 [M(D₁₁)+D]⁺ | 671.54685 |
| Precursor HDX 2 [M(D₁₁)+2D]²⁺ | 336.78020 |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 330.18122 | 312.17065 | 313.15467 | 347.20777 | 214.16624 | 197.13969 | 245.20844 |
| 2 | 415.27037 | 397.25980 | 398.24382 | 446.31257 | 313.27104 | 296.24449 | 330.29759 |
| 3 | 486.34387 | 468.33330 | 469.31732 | 659.47153 | 469.39730 | 452.37075 | 486.42385 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 146.06004 | a’ |
| 174.05495 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Glutamate receptor anatgonists from the spider Argiope lobata venom | E. V. Grishin, T. M. Volkova, A. S. Arseniev, Biorg. Khim. 1988, 14, 883-892 | A. lobata | | | |
| Isolation and structure analysis of components from venom of the spider Argiope lobata | E. V. Grishin, T. M. Volkova, A. S. Arseniev, Toxicon 1989, 27, 541-549 | A. lobata | Argiopinin 5 | NMR (ns), Amino acid analysis, Activity-studies | Link |
| Polyamine toxins from spiders and wasps | A. Schäfer, H. Benz, W. Fiedler, A. Guggisberg, S. Bienz, M. Hesse, The Alkaloids 1994, 45, 1-125 | A. lobata | Arg 658 / Argiopinin 5 | Review | Link |
| Acylpolyamines: Mass spectrometric analytical methods for Araneidae spider acylpolyamines | Y. Itagaki , T. Nakajima , Toxin Rev. 2000, 19, 23-52 | A. lobata | Arg 658 | Review | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Argiope lobata | Araneidae | 1989 / E. V. Grishin |