Navigation :
4-OH-IndAc43
General Description
| Name | Value |
|---|
| Level | S-3 / C-3 |
| Discovered | 2009 / O. lugubris |
| Synonym | OZ 318B |
| Molecular formula | C₁₇H₂₆N₄O₂ |
| CAS | — |
| SMILES | O=C(NCCCCNCCCN)CC1=CNC2=C1C(O)=CC=C2 |
| InChI | InChI=1S/C17H26N4O2/c18-7-4-9-19-8-1-2-10-20-16(23)11-13-12-21-14-5-3-6-15(22)17(13)14/h3,5-6,12,19,21-22H,1-2,4,7-11,18H2,(H,20,23) |
| |
| Precursor 1 [M+H]⁺ | 319.21285 |
| Precursor 2 [M+2H]²⁺ | 160.11006 |
| Precursor 3 | |
| |
| HDX | 6 |
| Precursor HDX 1 [M(D₆)+D]⁺ | 326.25679 |
| Precursor HDX 2 [M(D₆)+2D]²⁺ | 164.13517 |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 245.12845 | 227.11789 | 228.10191 | 262.15500 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 302.18630 | 284.17574 | 285.15975 | 319.21285 | 129.13862 | 112.11208 | 146.16517 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 146.06004 | a’ |
| 174.05495 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | O. lugubris | OZ 318B | nLC-ESI-MS/MS | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Ozyptila lugubris | Thomisidae | 2009 / S. Eichenberger |