Navigation :
4-OH-IndAc3(OH)335
335.png)
General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2020 / Hololena sp. & P. luctuosa |
| Synonym | — |
| Molecular formula | C₂₄H₄₂N₆O₃ |
| CAS | — |
| SMILES | O=C(CC1=CNC2=C1C(O)=CC=C2)NCCCN(O)CCCNCCCNCCCCCN |
| InChI | InChI=1S/C24H42N6O3/c25-10-2-1-3-11-26-12-5-13-27-14-6-16-30(33)17-7-15-28-23(32)18-20-19-29-21-8-4-9-22(31)24(20)21/h4,8-9,19,26-27,29,31,33H,1-3,5-7,10-18,25H2,(H,28,32) |
| |
| Precursor 1 [M+H]⁺ | 463.33912 |
| Precursor 2 [M+2H]²⁺ | 232.17320 |
| Precursor 3 | |
| |
| HDX | 8 |
| Precursor HDX [M(D₈)+D]⁺ | 472.39561 |
| Precursor HDX 2 [M(D₈)+2D]²⁺ | 237.20458 |
| Precursor HDX 3 | |
| |
| Rt | 7.54 |
| Rt HDX | 5.77 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 231.11280 | 213.10224 | 214.08626 | 264.13427 | 86.09643 | 69.06988 | 103.12297 |
| 2 | 304.16557 | 286.15500 | 287.13902 | 321.19212 | 143.15428 | 126.12773 | 160.18082 |
| 3 | 361.22342 | 343.21285 | 344.19687 | 378.24997 | 200.21212 | 183.18558 | 233.23359 |
| 4 | 446.31257 | 428.30200 | 429.28602 | 463.33912 | 273.26489 | 256.23834 | 290.29144 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 146.06004 | a’ |
| 174.05495 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 463.33912 | | Hololena sp. | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | Hololena sp. | Spider Pharm, USA | Y. M. Forster |
| Data | 463.33912 | | P. luctuosa | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | 232.17320 | | P. luctuosa | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | HDX | | P. luctuosa | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Low molecular mass compounds in spider venom | Y. M. Forster, S. Bienz, L. Bigler, 2020, in preparation | div. | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Hololena sp. | Agelenidae | 2020 / Y. M. Forster |
| Pireneitega luctuosa | Agelenidae | 2020 / Y. M. Forster |