Navigation :
4-OH-IndAc35
General Description
| Name | Value |
|---|
| Level | S-3 / C-3 |
| Discovered | 2009 / O. lugubris |
| Synonym | OZ 332A |
| Molecular formula | C₁₈H₂₈N₄O₂ |
| CAS | — |
| SMILES | O=C(NCCCNCCCCCN)CC1=CNC2=C1C(O)=CC=C2 |
| InChI | InChI=1S/C18H28N4O2/c19-8-2-1-3-9-20-10-5-11-21-17(24)12-14-13-22-15-6-4-7-16(23)18(14)15/h4,6-7,13,20,22-23H,1-3,5,8-12,19H2,(H,21,24) |
| |
| Precursor 1 [M+H]⁺ | 333.22850 |
| Precursor 2 [M+2H]²⁺ | 167.11789 |
| Precursor 3 | |
| |
| HDX | 6 |
| Precursor HDX 1 [M(D₆)+D]⁺ | 340.27244 |
| Precursor HDX 2 [M(D₆)+2D]²⁺ | 171.14300 |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 231.11280 | 213.10224 | 214.08626 | 248.13935 | 86.09643 | 69.06988 | 103.12297 |
| 2 | 316.20195 | 298.19139 | 299.17540 | 333.22850 | 143.15428 | 126.12773 | 160.18082 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 146.06004 | a’ |
| 174.05495 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | O. lugubris | OZ 332A | nLC-ESI-MS/MS | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Ozyptila lugubris | Thomisidae | 2009 / S. Eichenberger |