Navigation :
4-OH-IndAcßAla353

General Description
| Name | Value |
|---|
| Level | S-3 / C-3 |
| Discovered | 2009 / Lachesana sp. |
| Synonym | LH 460 |
| Molecular formula | C₂₄H₄₀N₆O₃ |
| CAS | — |
| SMILES | O=C(NCCC(NCCCNCCCCCNCCCN)=O)CC1=CNC2=C1C(O)=CC=C2 |
| InChI | InChI=1S/C24H40N6O3/c25-10-5-13-26-11-2-1-3-12-27-14-6-15-28-22(32)9-16-29-23(33)17-19-18-30-20-7-4-8-21(31)24(19)20/h4,7-8,18,26-27,30-31H,1-3,5-6,9-17,25H2,(H,28,32)(H,29,33) |
| |
| Precursor 1 [M+H]⁺ | 461.32347 |
| Precursor 2 [M+2H]²⁺ | 231.16537 |
| Precursor 3 | |
| |
| HDX | 8 |
| Precursor HDX 1 [M(D₈)+D]⁺ | 470.37996 |
| Precursor HDX 2 [M(D₈)+2D]²⁺ | 236.19675 |
| Precursor HDX 3 | |
| |
| Rt | |
| Rt HDX | |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 245.09207 | 227.08150 | 228.06552 | 262.11862 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 302.14992 | 284.13935 | 285.12337 | 319.17647 | 143.15428 | 126.12773 | 160.18082 |
| 3 | 387.23907 | 369.22850 | 370.21252 | 404.26562 | 200.21212 | 183.18558 | 217.23867 |
| 4 | 444.29692 | 426.28635 | 427.27037 | 461.32347 | 271.24924 | 254.22269 | 288.27579 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 146.06004 | a’ |
| 174.05495 | a0 |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| | | | | |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Development of a high-resolution MS-based method for the structural elucidation of polyamine spider toxins | S. Eichenberger, PhD-Thesis, University of Zurich 2009, 1-156 | Lachesana sp. | LH 460 | nLC-ESI-MS/MS | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Lachesana sp. | Zodariidae | 2009 / S. Eichenberger |