Navigation :
4-OH-Bz4(OH)3(OH)33
3(OH)33.png)
3(OH)33_Aa.png?classes=border)
General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2020 / A. aperta |
| Synonym | — |
| Molecular formula | C₂₀H₃₇N₅O₄ |
| CAS | — |
| SMILES | O=C(C1=CC=C(O)C=C1)NCCCCN(O)CCCN(O)CCCNCCCN |
| InChI | InChI=1S/C20H37N5O4/c21-10-3-11-22-12-4-15-25(29)17-5-16-24(28)14-2-1-13-23-20(27)18-6-8-19(26)9-7-18/h6-9,22,26,28-29H,1-5,10-17,21H2,(H,23,27) |
| |
| Precursor 1 [M+H]⁺ | 412.29183 |
| Precursor 2 [M+2H]²⁺ | 206.64955 |
| Precursor 3 | |
| |
| HDX | 7 |
| Precursor HDX 1 [M(D₇)+D]⁺ | 420.34205 |
| Precursor HDX 2 [M(D₇)+2D]²⁺ | 211.17780 |
| Precursor HDX 3 | |
| |
| Rt | 6.34 |
| Rt HDX | 4.85 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 192.10191 | 174.09134 | 175.07536 | 225.12337 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 265.15467 | 247.14410 | 248.12812 | 298.17613 | 115.12297 | 98.09643 | 148.14444 |
| 3 | 338.20743 | 320.19687 | 321.18088 | 355.23398 | 188.17574 | 171.14919 | 221.19720 |
| 4 | 395.26528 | 377.25472 | 378.23873 | 412.29183 | 275.24415 | 258.21760 | 292.27070 |
Additional MS/MS fragments
| m/z | Annotation |
|---|
| 114.09134 | y2’ |
| 121.02841 | a0 |
| 131.11789 | z2’ |
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 412.29183 | | A. aperta | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | HDX | | A. aperta | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | 412.29183 | | H. curta | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | HDX | | H. curta | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | 412.29183 | | Hololena sp. | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | | Hololena sp. | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| Low molecular mass compounds in spider venom | Y. M. Forster, S. Bienz, L. Bigler, 2020, in preparation | div. | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Agelenopsis aperta | Agelenidae | 2020 / Y. M. Forster |
| Hololena curta | Agelenidae | 2020 / Y. M. Forster |
| Hololena sp. | Agelenidae | 2020 / Y. M. Forster |