Navigation :
4-OH-Bz3(OH)343
343.png)
General Description
| Name | Value |
|---|
| Level | S-3 / C-1 |
| Discovered | 2001 / A. aperta |
| Synonym | AG 395 |
| Molecular formula | C₂₀H₃₇N₅O₃ |
| CAS | 389872-52-0 |
| SMILES | O=C(NCCCN(O)CCCNCCCCNCCCN)C1=CC=C(O)C=C1 |
| InChI | InChI=1S/C20H37N5O3/c21-10-3-13-22-11-1-2-12-23-14-4-16-25(28)17-5-15-24-20(27)18-6-8-19(26)9-7-18/h6-9,22-23,26,28H,1-5,10-17,21H2,(H,24,27) |
| |
| Precursor 1 [M+H]⁺ | 396.29692 |
| Precursor 2 [M+2H]²⁺ | 198.65210 |
| Precursor 3 | |
| |
| HDX | 7 |
| Precursor HDX 1 [M(D₇)+D]⁺ | 404.34713 |
| Precursor HDX 2 [M(D₇)+2D]²⁺ | 203.18034 |
| Precursor HDX 3 | |
| |
| Rt | 4.28 |
| Rt HDX | 3.05 |
Calculated MS/MS fragments
| # | a | b | c | ta | z | y | tz |
|---|
| 1 | 178.08626 | 160.07569 | 161.05971 | 211.10772 | 58.06513 | 41.03858 | 75.09167 |
| 2 | 251.13902 | 233.12845 | 234.11247 | 268.16557 | 129.13862 | 112.11208 | 146.16517 |
| 3 | 322.21252 | 304.20195 | 305.18597 | 339.23907 | 186.19647 | 169.16993 | 219.21794 |
| 4 | 379.27037 | 361.25980 | 362.24382 | 396.29692 | 259.24924 | 242.22269 | 276.27579 |
Additional MS/MS fragments
Recorded MS/MS spectra
| pdf | Precursor | Co-eluting | Spider | Source | Author |
|---|
| Data | 396.29692 | 4-OH-Bz3(OH)334 | A. aperta | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | 198.65210 | 4-OH-Bz3(OH)334 | A. aperta | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | HDX | 4-OH-Bz3(OH)334 | A. aperta | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | 396.29692 | 4-OH-Bz3(OH)334 | A. potteri | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | 198.65210 | 4-OH-Bz3(OH)334 | A. potteri | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | HDX | 4-OH-Bz3(OH)334 | A. potteri | Fauna Laboratories Ltd., KAZ | Y. M. Forster |
| Data | 396.29692 | 4-OH-Bz3(OH)334 | Hololena sp. | Spider Pharm, USA | Y. M. Forster |
| Data | 198.65210 | 4-OH-Bz3(OH)334 | Hololena sp. | Spider Pharm, USA | Y. M. Forster |
| Data | HDX | 4-OH-Bz3(OH)334 | Hololena sp. | Spider Pharm, USA | Y. M. Forster |
References
| Title | Reference | Spider | Name | Content | Link |
|---|
| The acylpolyamines from the venom of the spider Agelenopsis aperta | S. Chesnov, L. Bigler, M. Hesse, Helv. Chim. Acta 2001, 84, 2178-2197 | A. aperta | AG 395a | APCI-MS/MS | Link |
| Low molecular mass compounds in spider venom | Y. M. Forster, S. Bienz, L. Bigler, 2020, in preparation | div. | | | Link |
Spider species
| Spider species | Family | Discovered |
|---|
| Agelenopsis aperta | Agelenidae | 2001 / S. Chesnov |
| Agelenopsis potteri | Agelenidae | 2020 / Y. M. Forster |
| Hololena sp. | Agelenidae | 2020 / Y. M. Forster |